* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | RARECHEM AL BP 0457 |
English Synonyms: | RARECHEM AL BP 0457 |
MDL Number.: | MFCD06209275 |
H bond acceptor: | 3 |
H bond donor: | 1 |
Smile: | c1ccc(cc1)c2c(c3ccccc3[nH]2)C4OCCO4 |
InChi: | InChI=1S/C17H15NO2/c1-2-6-12(7-3-1)16-15(17-19-10-11-20-17)13-8-4-5-9-14(13)18-16/h1-9,17-18H,10-11H2 |
InChiKey: | InChIKey=GZVRVMOUNRCHDJ-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.