* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | 8-(1,3-DIOXOLAN-2-YL)-QUINOLINE |
| CAS: | 773092-97-0 |
| English Synonyms: | 8-(1,3-DIOXOLAN-2-YL)-QUINOLINE ; QUINOLINE, 8-(1,3-DIOXOLAN-2-YL)- |
| MDL Number.: | MFCD06209298 |
| H bond acceptor: | 3 |
| H bond donor: | 0 |
| Smile: | c1cc2cccnc2c(c1)C3OCCO3 |
| InChi: | InChI=1S/C12H11NO2/c1-3-9-4-2-6-13-11(9)10(5-1)12-14-7-8-15-12/h1-6,12H,7-8H2 |
| InChiKey: | InChIKey=LYJRUEHWVFFOKC-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.