* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | RARECHEM AL BP 0488 |
| English Synonyms: | RARECHEM AL BP 0488 |
| MDL Number.: | MFCD06209303 |
| H bond acceptor: | 8 |
| H bond donor: | 0 |
| Smile: | CC(=O)Oc1cc(cc(c1OC(=O)C)OC(=O)C)C2OCCO2 |
| InChi: | InChI=1S/C15H16O8/c1-8(16)21-12-6-11(15-19-4-5-20-15)7-13(22-9(2)17)14(12)23-10(3)18/h6-7,15H,4-5H2,1-3H3 |
| InChiKey: | InChIKey=FPVOUEFOVSJYCC-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.