* If the product has intellectual property rights, a license granted is must or contact us.
|
|
Product Name: | RARECHEM AL BP 0494 |
English Synonyms: | RARECHEM AL BP 0494 |
MDL Number.: | MFCD06209309 |
H bond acceptor: | 2 |
H bond donor: | 0 |
Smile: | c1cc(c(c(c1C(F)(F)F)C2OCCO2)F)Cl |
InChi: | InChI=1S/C10H7ClF4O2/c11-6-2-1-5(10(13,14)15)7(8(6)12)9-16-3-4-17-9/h1-2,9H,3-4H2 |
InChiKey: | InChIKey=APXWDCYFICJBIW-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.