* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | RARECHEM AL BP 1139 |
English Synonyms: | RARECHEM AL BP 1139 |
MDL Number.: | MFCD06209855 |
H bond acceptor: | 5 |
H bond donor: | 1 |
Smile: | c1cncnc1/C(=C\O)/C2OCCO2 |
InChi: | InChI=1S/C9H10N2O3/c12-5-7(9-13-3-4-14-9)8-1-2-10-6-11-8/h1-2,5-6,9,12H,3-4H2/b7-5+ |
InChiKey: | InChIKey=YBRTWIBAHNIEQW-FNORWQNLSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.