* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | RARECHEM AL BP 1155 |
English Synonyms: | RARECHEM AL BP 1155 |
MDL Number.: | MFCD06209871 |
H bond acceptor: | 3 |
H bond donor: | 1 |
Smile: | C/C(=C\N)/C1OCCO1 |
InChi: | InChI=1S/C6H11NO2/c1-5(4-7)6-8-2-3-9-6/h4,6H,2-3,7H2,1H3/b5-4+ |
InChiKey: | InChIKey=UKBHKCZENKXXHV-SNAWJCMRSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.