* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | RARECHEM AL BP 1270 |
English Synonyms: | RARECHEM AL BP 1270 |
MDL Number.: | MFCD06209976 |
H bond acceptor: | 3 |
H bond donor: | 0 |
Smile: | C1COC(O1)COCC(C(C(C(F)F)(F)F)(F)F)(F)F |
InChi: | InChI=1S/C9H10F8O3/c10-6(11)8(14,15)9(16,17)7(12,13)4-18-3-5-19-1-2-20-5/h5-6H,1-4H2 |
InChiKey: | InChIKey=PFLRAQYYEIUEIR-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.