* If the product has intellectual property rights, a license granted is must or contact us.
|
|
Product Name: | RARECHEM AL BP 1274 |
English Synonyms: | RARECHEM AL BP 1274 |
MDL Number.: | MFCD06209980 |
H bond acceptor: | 4 |
H bond donor: | 1 |
Smile: | c1cc(ccc1c2c(c[nH]n2)C3OCCO3)F |
InChi: | InChI=1S/C12H11FN2O2/c13-9-3-1-8(2-4-9)11-10(7-14-15-11)12-16-5-6-17-12/h1-4,7,12H,5-6H2,(H,14,15) |
InChiKey: | InChIKey=YIKVXTWVCIFTMD-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.