* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | RARECHEM AL BT 0298 |
| English Synonyms: | RARECHEM AL BT 0298 |
| MDL Number.: | MFCD06211963 |
| H bond acceptor: | 2 |
| H bond donor: | 2 |
| Smile: | Cc1cc(ccc1C(CCO)N)F.Cl |
| InChi: | InChI=1S/C10H14FNO.ClH/c1-7-6-8(11)2-3-9(7)10(12)4-5-13;/h2-3,6,10,13H,4-5,12H2,1H3;1H |
| InChiKey: | InChIKey=HSAZUSJOEXKMFI-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.