* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | RARECHEM AL BT 0300 |
English Synonyms: | RARECHEM AL BT 0300 |
MDL Number.: | MFCD06211965 |
H bond acceptor: | 3 |
H bond donor: | 2 |
Smile: | Cc1ccc(cc1)N(c2ccc(cc2)C)c3ccc(cc3)C(CCO)N.Cl |
InChi: | InChI=1S/C23H26N2O.ClH/c1-17-3-9-20(10-4-17)25(21-11-5-18(2)6-12-21)22-13-7-19(8-14-22)23(24)15-16-26;/h3-14,23,26H,15-16,24H2,1-2H3;1H |
InChiKey: | InChIKey=ALYBYYKMDRROME-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.