* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product_Name: | RARECHEM AL BT 0309 |
| EnglishSynonyms: | RARECHEM AL BT 0309 |
| pro_mdlNumber: | MFCD06211974 |
| pro_acceptors: | 2 |
| pro_donors: | 2 |
| pro_smile: | Cc1c(cc(c(c1F)F)C(CCO)N)F.Cl |
| InChi: | InChI=1S/C10H12F3NO.ClH/c1-5-7(11)4-6(8(14)2-3-15)10(13)9(5)12;/h4,8,15H,2-3,14H2,1H3;1H |
| InChiKey: | InChIKey=TWLQZYJFUCUAPK-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.