* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | RARECHEM AL BT 0313 |
English Synonyms: | RARECHEM AL BT 0313 |
MDL Number.: | MFCD06211978 |
H bond acceptor: | 3 |
H bond donor: | 2 |
Smile: | Cc1cc(c(cc1OC)C)C(CCO)N.Cl |
InChi: | InChI=1S/C12H19NO2.ClH/c1-8-7-12(15-3)9(2)6-10(8)11(13)4-5-14;/h6-7,11,14H,4-5,13H2,1-3H3;1H |
InChiKey: | InChIKey=KMBOZLUKRLJJIR-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.