* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | RARECHEM AL BT 0318 |
English Synonyms: | RARECHEM AL BT 0318 |
MDL Number.: | MFCD06211983 |
H bond acceptor: | 3 |
H bond donor: | 3 |
Smile: | c1cc(ccc1/C=C/CO)C(CCO)N.Cl |
InChi: | InChI=1S/C12H17NO2.ClH/c13-12(7-9-15)11-5-3-10(4-6-11)2-1-8-14;/h1-6,12,14-15H,7-9,13H2;1H/b2-1+; |
InChiKey: | InChIKey=VCYMZSKRMNMIGP-TYYBGVCCSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.