* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | RARECHEM AL BT 0326 |
English Synonyms: | RARECHEM AL BT 0326 |
MDL Number.: | MFCD06211990 |
H bond acceptor: | 3 |
H bond donor: | 2 |
Smile: | CCc1ccc(o1)C(CCO)N.Cl |
InChi: | InChI=1S/C9H15NO2.ClH/c1-2-7-3-4-9(12-7)8(10)5-6-11;/h3-4,8,11H,2,5-6,10H2,1H3;1H |
InChiKey: | InChIKey=IIGBZNLNUCSIDT-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.