* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | RARECHEM AL BT 0331 |
English Synonyms: | RARECHEM AL BT 0331 |
MDL Number.: | MFCD06211995 |
H bond acceptor: | 4 |
H bond donor: | 3 |
Smile: | COc1cc(ccc1C(CCO)N)O.Cl |
InChi: | InChI=1S/C10H15NO3.ClH/c1-14-10-6-7(13)2-3-8(10)9(11)4-5-12;/h2-3,6,9,12-13H,4-5,11H2,1H3;1H |
InChiKey: | InChIKey=PVJKSEXRMHEJLM-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.