* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | RARECHEM AL BT 0354 |
English Synonyms: | RARECHEM AL BT 0354 |
MDL Number.: | MFCD06212015 |
H bond acceptor: | 4 |
H bond donor: | 2 |
Smile: | c1ccc(cc1)COc2ccc(cc2OCc3ccccc3)C(CCO)N.Cl |
InChi: | InChI=1S/C23H25NO3.ClH/c24-21(13-14-25)20-11-12-22(26-16-18-7-3-1-4-8-18)23(15-20)27-17-19-9-5-2-6-10-19;/h1-12,15,21,25H,13-14,16-17,24H2;1H |
InChiKey: | InChIKey=BCONAEYHOHKSRH-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.