* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | RARECHEM AL BT 0359 |
English Synonyms: | RARECHEM AL BT 0359 |
MDL Number.: | MFCD06212020 |
H bond acceptor: | 5 |
H bond donor: | 2 |
Smile: | c1cc(c(c(c1)Cl)C(CCO)N)[N+](=O)[O-].Cl |
InChi: | InChI=1S/C9H11ClN2O3.ClH/c10-6-2-1-3-8(12(14)15)9(6)7(11)4-5-13;/h1-3,7,13H,4-5,11H2;1H |
InChiKey: | InChIKey=HEDMTIAIYMMQTM-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.