* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | RARECHEM AL BT 0363 |
| English Synonyms: | RARECHEM AL BT 0363 |
| MDL Number.: | MFCD06212024 |
| H bond acceptor: | 4 |
| H bond donor: | 2 |
| Smile: | COc1cc(c(cc1C(CCO)N)Br)OC.Cl |
| InChi: | InChI=1S/C11H16BrNO3.ClH/c1-15-10-6-11(16-2)8(12)5-7(10)9(13)3-4-14;/h5-6,9,14H,3-4,13H2,1-2H3;1H |
| InChiKey: | InChIKey=ZQSBISJSTOZCBT-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.