* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | RARECHEM AL BT 0372 |
| English Synonyms: | RARECHEM AL BT 0372 |
| MDL Number.: | MFCD06212033 |
| H bond acceptor: | 5 |
| H bond donor: | 4 |
| Smile: | COc1cc(cc(c1O)O)C(CCO)N.Cl |
| InChi: | InChI=1S/C10H15NO4.ClH/c1-15-9-5-6(7(11)2-3-12)4-8(13)10(9)14;/h4-5,7,12-14H,2-3,11H2,1H3;1H |
| InChiKey: | InChIKey=ZQFVYHDEXBSDPQ-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.