* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | RARECHEM AL BT 0381 |
English Synonyms: | RARECHEM AL BT 0381 |
MDL Number.: | MFCD06212041 |
H bond acceptor: | 3 |
H bond donor: | 3 |
Smile: | c1cc(c(cc1O)Cl)C(CCO)N.Cl |
InChi: | InChI=1S/C9H12ClNO2.ClH/c10-8-5-6(13)1-2-7(8)9(11)3-4-12;/h1-2,5,9,12-13H,3-4,11H2;1H |
InChiKey: | InChIKey=CVVYTTXXVBDNFX-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.