* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | RARECHEM AL BT 0392 |
English Synonyms: | RARECHEM AL BT 0392 |
MDL Number.: | MFCD06212051 |
H bond acceptor: | 5 |
H bond donor: | 5 |
Smile: | c1c(cc(c(c1O)O)O)C(CCO)N.O.Cl |
InChi: | InChI=1S/C9H13NO4.ClH.H2O/c10-6(1-2-11)5-3-7(12)9(14)8(13)4-5;;/h3-4,6,11-14H,1-2,10H2;1H;1H2 |
InChiKey: | InChIKey=NFEJPISKMLOASY-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.