* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | RARECHEM AL BT 0393 |
English Synonyms: | RARECHEM AL BT 0393 |
MDL Number.: | MFCD06212052 |
H bond acceptor: | 3 |
H bond donor: | 2 |
Smile: | c1cc(c(cc1Cl)Cl)c2ccc(o2)C(CCO)N.Cl |
InChi: | InChI=1S/C13H13Cl2NO2.ClH/c14-8-1-2-9(10(15)7-8)12-3-4-13(18-12)11(16)5-6-17;/h1-4,7,11,17H,5-6,16H2;1H |
InChiKey: | InChIKey=UEACIDAEOYQISA-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.