* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | RARECHEM AL BT 0422 |
English Synonyms: | RARECHEM AL BT 0422 |
MDL Number.: | MFCD06212081 |
H bond acceptor: | 4 |
H bond donor: | 3 |
Smile: | CN(CCO)c1ccc(cc1)C(CCO)N.Cl |
InChi: | InChI=1S/C12H20N2O2.ClH/c1-14(7-9-16)11-4-2-10(3-5-11)12(13)6-8-15;/h2-5,12,15-16H,6-9,13H2,1H3;1H |
InChiKey: | InChIKey=HAOZASNRXZAEAO-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.