* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | RARECHEM AL BT 0435 |
English Synonyms: | RARECHEM AL BT 0435 |
MDL Number.: | MFCD06212092 |
H bond acceptor: | 3 |
H bond donor: | 2 |
Smile: | Cc1cc(ccc1C(CCO)N)OC.Cl |
InChi: | InChI=1S/C11H17NO2.ClH/c1-8-7-9(14-2)3-4-10(8)11(12)5-6-13;/h3-4,7,11,13H,5-6,12H2,1-2H3;1H |
InChiKey: | InChIKey=QVVXLEJVUGKJJG-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.