* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | RARECHEM AL BT 0438 |
English Synonyms: | RARECHEM AL BT 0438 |
MDL Number.: | MFCD06212095 |
H bond acceptor: | 4 |
H bond donor: | 2 |
Smile: | COc1cc(cc(c1OC)Cl)C(CCO)N.Cl |
InChi: | InChI=1S/C11H16ClNO3.ClH/c1-15-10-6-7(9(13)3-4-14)5-8(12)11(10)16-2;/h5-6,9,14H,3-4,13H2,1-2H3;1H |
InChiKey: | InChIKey=QXZVMXONIUSCJH-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.