* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | RARECHEM AL BT 0450 |
English Synonyms: | RARECHEM AL BT 0450 |
MDL Number.: | MFCD06212107 |
H bond acceptor: | 3 |
H bond donor: | 2 |
Smile: | c1cc(oc1C(CCO)N)Cl.Cl |
InChi: | InChI=1S/C7H10ClNO2.ClH/c8-7-2-1-6(11-7)5(9)3-4-10;/h1-2,5,10H,3-4,9H2;1H |
InChiKey: | InChIKey=YAWZKMIWFCLRFY-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.