* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | RARECHEM AL BT 0461 |
| English Synonyms: | RARECHEM AL BT 0461 |
| MDL Number.: | MFCD06212118 |
| H bond acceptor: | 4 |
| H bond donor: | 3 |
| Smile: | COc1cc(cc(c1O)C(CCO)N)I.Cl |
| InChi: | InChI=1S/C10H14INO3.ClH/c1-15-9-5-6(11)4-7(10(9)14)8(12)2-3-13;/h4-5,8,13-14H,2-3,12H2,1H3;1H |
| InChiKey: | InChIKey=NYQYYXIJBSRKAJ-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.