* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | RARECHEM AL BT 0468 |
English Synonyms: | RARECHEM AL BT 0468 |
MDL Number.: | MFCD06212124 |
H bond acceptor: | 3 |
H bond donor: | 3 |
Smile: | C=CCc1cccc(c1O)C(CCO)N.Cl |
InChi: | InChI=1S/C12H17NO2.ClH/c1-2-4-9-5-3-6-10(12(9)15)11(13)7-8-14;/h2-3,5-6,11,14-15H,1,4,7-8,13H2;1H |
InChiKey: | InChIKey=PYPQUISDTKIAFD-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.