* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | RARECHEM AL BT 0471 |
| English Synonyms: | RARECHEM AL BT 0471 |
| MDL Number.: | MFCD06212127 |
| H bond acceptor: | 6 |
| H bond donor: | 3 |
| Smile: | c1c(cc(c(c1C(CCO)N)O)Br)[N+](=O)[O-].Cl |
| InChi: | InChI=1S/C9H11BrN2O4.ClH/c10-7-4-5(12(15)16)3-6(9(7)14)8(11)1-2-13;/h3-4,8,13-14H,1-2,11H2;1H |
| InChiKey: | InChIKey=GGPAWSRVLSMOFF-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.