* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | RARECHEM AL BT 0485 |
English Synonyms: | RARECHEM AL BT 0485 |
MDL Number.: | MFCD06212140 |
H bond acceptor: | 5 |
H bond donor: | 2 |
Smile: | c1cc(c(cc1C(CCO)N)[N+](=O)[O-])SC2CCCCC2.Cl |
InChi: | InChI=1S/C15H22N2O3S.ClH/c16-13(8-9-18)11-6-7-15(14(10-11)17(19)20)21-12-4-2-1-3-5-12;/h6-7,10,12-13,18H,1-5,8-9,16H2;1H |
InChiKey: | InChIKey=RKGHTVRQXBJZEM-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.