* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | RARECHEM AL BT 0486 |
English Synonyms: | RARECHEM AL BT 0486 |
MDL Number.: | MFCD06212141 |
H bond acceptor: | 5 |
H bond donor: | 2 |
Smile: | c1cc(ccc1Sc2ccc(cc2[N+](=O)[O-])C(CCO)N)Cl.Cl |
InChi: | InChI=1S/C15H15ClN2O3S.ClH/c16-11-2-4-12(5-3-11)22-15-6-1-10(13(17)7-8-19)9-14(15)18(20)21;/h1-6,9,13,19H,7-8,17H2;1H |
InChiKey: | InChIKey=CPMMXKDMCJLKKO-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.