* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | RARECHEM AL BW 0526 |
| English Synonyms: | RARECHEM AL BW 0526 |
| MDL Number.: | MFCD06212695 |
| H bond acceptor: | 3 |
| H bond donor: | 2 |
| Smile: | CCCCOc1ccc(c(c1)CN)CN |
| InChi: | InChI=1S/C12H20N2O/c1-2-3-6-15-12-5-4-10(8-13)11(7-12)9-14/h4-5,7H,2-3,6,8-9,13-14H2,1H3 |
| InChiKey: | InChIKey=VPQUZIOTPDOCNT-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.