* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | RARECHEM AL BW 0535 |
English Synonyms: | RARECHEM AL BW 0535 |
MDL Number.: | MFCD06212702 |
H bond acceptor: | 3 |
H bond donor: | 2 |
Smile: | CCCCCOc1ccc(c(c1)CN)CN |
InChi: | InChI=1S/C13H22N2O/c1-2-3-4-7-16-13-6-5-11(9-14)12(8-13)10-15/h5-6,8H,2-4,7,9-10,14-15H2,1H3 |
InChiKey: | InChIKey=QUSUHBGXCKQQSB-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.