* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | RARECHEM AL BW 0540 |
English Synonyms: | RARECHEM AL BW 0540 |
MDL Number.: | MFCD06212703 |
H bond acceptor: | 6 |
H bond donor: | 3 |
Smile: | c1cc(c(cc1[N+](=O)[O-])CN)NCCO |
InChi: | InChI=1S/C9H13N3O3/c10-6-7-5-8(12(14)15)1-2-9(7)11-3-4-13/h1-2,5,11,13H,3-4,6,10H2 |
InChiKey: | InChIKey=PCSSFARGJPSZEU-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.