* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | RARECHEM AL BW 0647 |
English Synonyms: | RARECHEM AL BW 0647 |
MDL Number.: | MFCD06212770 |
H bond acceptor: | 3 |
H bond donor: | 1 |
Smile: | CC(C)Oc1cccc(c1CN)OCC(F)(F)F |
InChi: | InChI=1S/C12H16F3NO2/c1-8(2)18-11-5-3-4-10(9(11)6-16)17-7-12(13,14)15/h3-5,8H,6-7,16H2,1-2H3 |
InChiKey: | InChIKey=VCVDSQHLLVEVOO-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.