* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | RARECHEM AL BW 0803 |
English Synonyms: | RARECHEM AL BW 0803 |
MDL Number.: | MFCD06212870 |
H bond acceptor: | 3 |
H bond donor: | 1 |
Smile: | CSc1c(cn(n1)c2ccccc2)CN |
InChi: | InChI=1S/C11H13N3S/c1-15-11-9(7-12)8-14(13-11)10-5-3-2-4-6-10/h2-6,8H,7,12H2,1H3 |
InChiKey: | InChIKey=MCEZBTRILMYIQB-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.