* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | RARECHEM AL BW 0817 |
English Synonyms: | RARECHEM AL BW 0817 |
MDL Number.: | MFCD06212878 |
H bond acceptor: | 3 |
H bond donor: | 1 |
Smile: | c1cc(c(cc1CN)Cl)S(=O)(=O)Cl |
InChi: | InChI=1S/C7H7Cl2NO2S/c8-6-3-5(4-10)1-2-7(6)13(9,11)12/h1-3H,4,10H2 |
InChiKey: | InChIKey=ZZIOCBZIIGOKBQ-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.