* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | RARECHEM AL BW 1547 |
English Synonyms: | RARECHEM AL BW 1547 |
MDL Number.: | MFCD06213350 |
H bond acceptor: | 4 |
H bond donor: | 1 |
Smile: | COC(=O)c1ccccc1OCCCCCN |
InChi: | InChI=1S/C13H19NO3/c1-16-13(15)11-7-3-4-8-12(11)17-10-6-2-5-9-14/h3-4,7-8H,2,5-6,9-10,14H2,1H3 |
InChiKey: | InChIKey=QDOAXDGGMAFXJO-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.