* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | RARECHEM AL BW 1572 |
English Synonyms: | RARECHEM AL BW 1572 |
MDL Number.: | MFCD06213364 |
H bond acceptor: | 5 |
H bond donor: | 4 |
Smile: | C(c1c(nc(s1)Cl)Cl)N/C(=C(/CN)\N)/CN |
InChi: | InChI=1S/C8H13Cl2N5S/c9-7-6(16-8(10)15-7)3-14-5(2-12)4(13)1-11/h14H,1-3,11-13H2/b5-4- |
InChiKey: | InChIKey=NBFWEFOHNUGMDK-PLNGDYQASA-N |
* If the product has intellectual property rights, a license granted is must or contact us.