* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | RARECHEM AL BW 1709 |
English Synonyms: | RARECHEM AL BW 1709 |
MDL Number.: | MFCD06213447 |
H bond acceptor: | 2 |
H bond donor: | 1 |
Smile: | c1cc(ccc1C(CN)c2ccc(cc2)F)C(=O)c3ccc(cc3)F |
InChi: | InChI=1S/C21H17F2NO/c22-18-9-5-15(6-10-18)20(13-24)14-1-3-16(4-2-14)21(25)17-7-11-19(23)12-8-17/h1-12,20H,13,24H2 |
InChiKey: | InChIKey=QLKSSIOVZPTCGF-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.