* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | RARECHEM AL BW 1729 |
English Synonyms: | RARECHEM AL BW 1729 |
MDL Number.: | MFCD06213456 |
H bond acceptor: | 1 |
H bond donor: | 1 |
Smile: | c1cc(c(c(c1CCN)F)F)C(F)(F)F |
InChi: | InChI=1S/C9H8F5N/c10-7-5(3-4-15)1-2-6(8(7)11)9(12,13)14/h1-2H,3-4,15H2 |
InChiKey: | InChIKey=YLPXFCBCZLHRKO-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.