* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | RARECHEM AL BW 1748 |
English Synonyms: | RARECHEM AL BW 1748 |
MDL Number.: | MFCD06213468 |
H bond acceptor: | 5 |
H bond donor: | 3 |
Smile: | CCOC(=O)c1cc(c(c(c1O)Br)N)CN |
InChi: | InChI=1S/C10H13BrN2O3/c1-2-16-10(15)6-3-5(4-12)8(13)7(11)9(6)14/h3,14H,2,4,12-13H2,1H3 |
InChiKey: | InChIKey=CMVPRJHCIJQBID-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.