* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | RARECHEM AL BW 1830 |
English Synonyms: | RARECHEM AL BW 1830 |
MDL Number.: | MFCD06213505 |
H bond acceptor: | 4 |
H bond donor: | 1 |
Smile: | CCOC(=O)C[n+]1ccc(cc1)CN.[Br-] |
InChi: | InChI=1S/C10H15N2O2.BrH/c1-2-14-10(13)8-12-5-3-9(7-11)4-6-12;/h3-6H,2,7-8,11H2,1H3;1H/q+1;/p-1 |
InChiKey: | InChIKey=FXHAEEMKHVQJIC-UHFFFAOYSA-M |
* If the product has intellectual property rights, a license granted is must or contact us.