* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | RARECHEM AL BW 1840 |
English Synonyms: | RARECHEM AL BW 1840 |
MDL Number.: | MFCD06213511 |
H bond acceptor: | 5 |
H bond donor: | 1 |
Smile: | [B-](F)(F)(F)F.c1cc(ccc1C[n+]2ccc(cc2)CN)[N+](=O)[O-] |
InChi: | InChI=1S/C13H14N3O2.BF4/c14-9-11-5-7-15(8-6-11)10-12-1-3-13(4-2-12)16(17)18;2-1(3,4)5/h1-8H,9-10,14H2;/q+1;-1 |
InChiKey: | InChIKey=OMUZQZQZMMHXMR-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.