* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | RARECHEM AL BW 1938 |
English Synonyms: | RARECHEM AL BW 1938 |
MDL Number.: | MFCD06213558 |
H bond acceptor: | 6 |
H bond donor: | 2 |
Smile: | c1cc[n+](c(c1)SCc2[nH]c(nn2)CCN)[O-] |
InChi: | InChI=1S/C10H13N5OS/c11-5-4-8-12-9(14-13-8)7-17-10-3-1-2-6-15(10)16/h1-3,6H,4-5,7,11H2,(H,12,13,14) |
InChiKey: | InChIKey=MRDDEQKFTPSMJH-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.