* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | RARECHEM AL BW 1939 |
English Synonyms: | RARECHEM AL BW 1939 |
MDL Number.: | MFCD06213559 |
H bond acceptor: | 4 |
H bond donor: | 2 |
Smile: | Cc1csc(c1CN)NC(=O)OCCCl |
InChi: | InChI=1S/C9H13ClN2O2S/c1-6-5-15-8(7(6)4-11)12-9(13)14-3-2-10/h5H,2-4,11H2,1H3,(H,12,13) |
InChiKey: | InChIKey=FOGFSFWNTYJMKA-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.