* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | RARECHEM AL BZ 0221 |
English Synonyms: | RARECHEM AL BZ 0221 |
MDL Number.: | MFCD06216345 |
H bond acceptor: | 3 |
H bond donor: | 2 |
Smile: | CCCCCCC/C=C/C(CC(=O)N)N |
InChi: | InChI=1S/C12H24N2O/c1-2-3-4-5-6-7-8-9-11(13)10-12(14)15/h8-9,11H,2-7,10,13H2,1H3,(H2,14,15)/b9-8+ |
InChiKey: | InChIKey=JWMXNADTBBKLOI-CMDGGOBGSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.