* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | RARECHEM AL BZ 0239 |
English Synonyms: | RARECHEM AL BZ 0239 |
MDL Number.: | MFCD06216363 |
H bond acceptor: | 6 |
H bond donor: | 5 |
Smile: | c1c(c(cc(c1O)O)O)C(CC(=O)N)N |
InChi: | InChI=1S/C9H12N2O4/c10-5(2-9(11)15)4-1-7(13)8(14)3-6(4)12/h1,3,5,12-14H,2,10H2,(H2,11,15) |
InChiKey: | InChIKey=BGIXOMJOONBZCV-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.