* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | RARECHEM AL BZ 0244 |
English Synonyms: | RARECHEM AL BZ 0244 |
MDL Number.: | MFCD06216368 |
H bond acceptor: | 5 |
H bond donor: | 2 |
Smile: | CC(=O)Oc1cccc(c1)C(CC(=O)N)N |
InChi: | InChI=1S/C11H14N2O3/c1-7(14)16-9-4-2-3-8(5-9)10(12)6-11(13)15/h2-5,10H,6,12H2,1H3,(H2,13,15) |
InChiKey: | InChIKey=DYWOHWSQTFUQLC-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.