* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | RARECHEM AL BZ 0259 |
English Synonyms: | RARECHEM AL BZ 0259 |
MDL Number.: | MFCD06216383 |
H bond acceptor: | 3 |
H bond donor: | 2 |
Smile: | CC(C)c1ccc(cc1)CC(C)C(CC(=O)N)N |
InChi: | InChI=1S/C15H24N2O/c1-10(2)13-6-4-12(5-7-13)8-11(3)14(16)9-15(17)18/h4-7,10-11,14H,8-9,16H2,1-3H3,(H2,17,18) |
InChiKey: | InChIKey=KPDPMOMENQNQHP-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.